C12H20N2S2 — CID 106475162
2-(tert-butylsulfanylmethyl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106475162) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is 2-(tert-butylsulfanylmethyl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(tert-butylsulfanylmethyl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475162 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(tert-butylsulfanylmethyl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(CSC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H20N2S2/c1-5-6-9-7-11(15)14-10(13-9)8-16-12(2,3)4/h7H,5-6,8H2,1-4H3,(H,13,14,15) |
| InChIKey | JEQLAMUQPYGHHY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|