C17H28N2S — CID 106475453
2-(4-tert-butylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106475453) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-(4-tert-butylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475453 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1cc(=S)nc(C2CCC(C(C)(C)C)CC2)[nH]1 |
| InChI | InChI=1S/C17H28N2S/c1-11(2)14-10-15(20)19-16(18-14)12-6-8-13(9-7-12)17(3,4)5/h10-13H,6-9H2,1-5H3,(H,18,19,20) |
| InChIKey | LSZIVQONPYRGPH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|