C13H18F2N2S — CID 114217011
2-(3,3-difluorocyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 114217011) has the molecular formula C13H18F2N2S and a molecular weight of 272.36 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-(3,3-difluorocyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 114217011 |
| Molecular Formula | C13H18F2N2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1cc(=S)nc(C2CCCC(F)(F)C2)[nH]1 |
| InChI | InChI=1S/C13H18F2N2S/c1-8(2)10-6-11(18)17-12(16-10)9-4-3-5-13(14,15)7-9/h6,8-9H,3-5,7H2,1-2H3,(H,16,17,18) |
| InChIKey | PVZNUKVFJRJCEK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|