C11H15F3N2S — CID 106481324
6-(2-methylpropyl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106481324) has the molecular formula C11H15F3N2S and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(2-methylpropyl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(2-methylpropyl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481324 |
| Molecular Formula | C11H15F3N2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-(2-methylpropyl)-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1cc(=S)nc(CCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H15F3N2S/c1-7(2)5-8-6-10(17)16-9(15-8)3-4-11(12,13)14/h6-7H,3-5H2,1-2H3,(H,15,16,17) |
| InChIKey | YBAAFOPAKWUMCU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|