C8H9F3N2S — CID 106475612
6-methyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106475612) has the molecular formula C8H9F3N2S and a molecular weight of 222.23 g/mol. Its IUPAC name is 6-methyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475612 |
| Molecular Formula | C8H9F3N2S |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 6-methyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(CCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H9F3N2S/c1-5-4-7(14)13-6(12-5)2-3-8(9,10)11/h4H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | SQNABKKBRUUAPF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|