C9H12N2S — CID 106475596
2-(cyclopropylmethyl)-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106475596) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(cyclopropylmethyl)-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475596 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(cyclopropylmethyl)-6-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(CC2CC2)[nH]1 |
| InChI | InChI=1S/C9H12N2S/c1-6-4-9(12)11-8(10-6)5-7-2-3-7/h4,7H,2-3,5H2,1H3,(H,10,11,12) |
| InChIKey | GAKPSICQIJWQSO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|