About 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole
2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 60977974) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole |
| PubChem CID | 60977974 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc2nc(CC3CCCC3)[nH]c2cc1C |
| InChI | InChI=1S/C15H20N2/c1-10-7-13-14(8-11(10)2)17-15(16-13)9-12-5-3-4-6-12/h7-8,12H,3-6,9H2,1-2H3,(H,16,17) |
| InChIKey | MKJZCTALNJDBCP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole?
The IUPAC name of 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole (CID 60977974) is 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole.
What is the SMILES notation for 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole?
The canonical SMILES for 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole is Cc1cc2nc(CC3CCCC3)[nH]c2cc1C.
What is the InChIKey of 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole?
The InChIKey is MKJZCTALNJDBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-10-7-13-14(8-11(10)2)17-15(16-13)9-12-5-3-4-6-12/h7-8,12H,3-6,9H2,1-2H3,(H,16,17).
What are the key properties of 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole?
2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole has a molecular weight of 228.34 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylmethyl)-5,6-dimethyl-1H-benzimidazole is sourced from PubChem (CID 60977974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).