C12H14F2N2S — CID 114217017
6-cyclopropyl-2-(3,3-difluorocyclopentyl)-1H-pyrimidine-4-thione (PubChem CID 114217017) has the molecular formula C12H14F2N2S and a molecular weight of 256.32 g/mol. Its IUPAC name is 6-cyclopropyl-2-(3,3-difluorocyclopentyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopropyl-2-(3,3-difluorocyclopentyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 114217017 |
| Molecular Formula | C12H14F2N2S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-cyclopropyl-2-(3,3-difluorocyclopentyl)-1H-pyrimidine-4-thione |
| SMILES | FC1(F)CCC(c2nc(=S)cc(C3CC3)[nH]2)C1 |
| InChI | InChI=1S/C12H14F2N2S/c13-12(14)4-3-8(6-12)11-15-9(7-1-2-7)5-10(17)16-11/h5,7-8H,1-4,6H2,(H,15,16,17) |
| InChIKey | LZAZXQSXKZMJRD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|