C9H9F3N2S — CID 106478363
6-cyclopropyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione (PubChem CID 106478363) has the molecular formula C9H9F3N2S and a molecular weight of 234.25 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopropyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478363 |
| Molecular Formula | C9H9F3N2S |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 6-cyclopropyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)Cc1nc(=S)cc(C2CC2)[nH]1 |
| InChI | InChI=1S/C9H9F3N2S/c10-9(11,12)4-7-13-6(5-1-2-5)3-8(15)14-7/h3,5H,1-2,4H2,(H,13,14,15) |
| InChIKey | KAVMBPBVQKJDSL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|