C10H10BrF3N2S — CID 106480309
5-bromo-6-cyclopropyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106480309) has the molecular formula C10H10BrF3N2S and a molecular weight of 327.17 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480309 |
| Molecular Formula | C10H10BrF3N2S |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)CCc1nc(=S)c(Br)c(C2CC2)[nH]1 |
| InChI | InChI=1S/C10H10BrF3N2S/c11-7-8(5-1-2-5)15-6(16-9(7)17)3-4-10(12,13)14/h5H,1-4H2,(H,15,16,17) |
| InChIKey | DUGRZEZURVBCME-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|