C9H10BrF3N2S — CID 106480027
5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione (PubChem CID 106480027) has the molecular formula C9H10BrF3N2S and a molecular weight of 315.16 g/mol. Its IUPAC name is 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480027 |
| Molecular Formula | C9H10BrF3N2S |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(CC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C9H10BrF3N2S/c1-4(2)7-6(10)8(16)15-5(14-7)3-9(11,12)13/h4H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | DYRYSKWVFKPVOO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|