C10H12BrF3N2S — CID 106479287
5-bromo-6-propyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106479287) has the molecular formula C10H12BrF3N2S and a molecular weight of 329.19 g/mol. Its IUPAC name is 5-bromo-6-propyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479287 |
| Molecular Formula | C10H12BrF3N2S |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 5-bromo-6-propyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(CCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C10H12BrF3N2S/c1-2-3-6-8(11)9(17)16-7(15-6)4-5-10(12,13)14/h2-5H2,1H3,(H,15,16,17) |
| InChIKey | HLDHPHMAYYZYIZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|