C12H14BrF3N2S — CID 106482093
5-bromo-6-cyclopentyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione (PubChem CID 106482093) has the molecular formula C12H14BrF3N2S and a molecular weight of 355.22 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482093 |
| Molecular Formula | C12H14BrF3N2S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)CCc1nc(=S)c(Br)c(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C12H14BrF3N2S/c13-9-10(7-3-1-2-4-7)17-8(18-11(9)19)5-6-12(14,15)16/h7H,1-6H2,(H,17,18,19) |
| InChIKey | QTJPWRQGIYOKJO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|