C13H16BrF3N2OS — CID 106482087
5-bromo-6-cyclopentyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106482087) has the molecular formula C13H16BrF3N2OS and a molecular weight of 385.25 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482087 |
| Molecular Formula | C13H16BrF3N2OS |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)COCCc1nc(=S)c(Br)c(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C13H16BrF3N2OS/c14-10-11(8-3-1-2-4-8)18-9(19-12(10)21)5-6-20-7-13(15,16)17/h8H,1-7H2,(H,18,19,21) |
| InChIKey | KORFBPIILGQVCZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|