C13H17BrF2N2OS — CID 106482088
5-bromo-6-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106482088) has the molecular formula C13H17BrF2N2OS and a molecular weight of 367.26 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482088 |
| Molecular Formula | C13H17BrF2N2OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | FC(F)COCCc1nc(=S)c(Br)c(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C13H17BrF2N2OS/c14-11-12(8-3-1-2-4-8)17-10(18-13(11)20)5-6-19-7-9(15)16/h8-9H,1-7H2,(H,17,18,20) |
| InChIKey | BYLRHHMAENTFND-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|