C12H17BrF2N2OS — CID 106481082
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 106481082) has the molecular formula C12H17BrF2N2OS and a molecular weight of 355.25 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481082 |
| Molecular Formula | C12H17BrF2N2OS |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(CCOCC(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C12H17BrF2N2OS/c1-7(2)5-8-11(13)12(19)17-10(16-8)3-4-18-6-9(14)15/h7,9H,3-6H2,1-2H3,(H,16,17,19) |
| InChIKey | VGVHFQMNKFXFDM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|