C11H16F2N2OS — CID 106475092
2-[2-(2,2-difluoroethoxy)ethyl]-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106475092) has the molecular formula C11H16F2N2OS and a molecular weight of 262.32 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475092 |
| Molecular Formula | C11H16F2N2OS |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(CCOCC(F)F)[nH]1 |
| InChI | InChI=1S/C11H16F2N2OS/c1-2-3-8-6-11(17)15-10(14-8)4-5-16-7-9(12)13/h6,9H,2-5,7H2,1H3,(H,14,15,17) |
| InChIKey | MRFYHJUXFZZRPM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|