C11H14F4N2OS — CID 106475146
6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106475146) has the molecular formula C11H14F4N2OS and a molecular weight of 298.31 g/mol. Its IUPAC name is 6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475146 |
| Molecular Formula | C11H14F4N2OS |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(COCC(F)(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C11H14F4N2OS/c1-2-3-7-4-9(19)17-8(16-7)5-18-6-11(14,15)10(12)13/h4,10H,2-3,5-6H2,1H3,(H,16,17,19) |
| InChIKey | LDORKDQWQGNJLO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|