C12H18F2N2OS — CID 106477881
2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106477881) has the molecular formula C12H18F2N2OS and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477881 |
| Molecular Formula | C12H18F2N2OS |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-methyl-5-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CCOCC(F)F)nc(=S)c1C(C)C |
| InChI | InChI=1S/C12H18F2N2OS/c1-7(2)11-8(3)15-10(16-12(11)18)4-5-17-6-9(13)14/h7,9H,4-6H2,1-3H3,(H,15,16,18) |
| InChIKey | YFMCOAYNSMGXDI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|