C11H13BrF4N2OS — CID 106479337
5-bromo-6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106479337) has the molecular formula C11H13BrF4N2OS and a molecular weight of 377.20 g/mol. Its IUPAC name is 5-bromo-6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479337 |
| Molecular Formula | C11H13BrF4N2OS |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 5-bromo-6-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(COCC(F)(F)C(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C11H13BrF4N2OS/c1-2-3-6-8(12)9(20)18-7(17-6)4-19-5-11(15,16)10(13)14/h10H,2-5H2,1H3,(H,17,18,20) |
| InChIKey | BYECIDLZVXJMGV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|