C12H16F4N2OS — CID 106477932
6-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106477932) has the molecular formula C12H16F4N2OS and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477932 |
| Molecular Formula | C12H16F4N2OS |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 6-methyl-5-propan-2-yl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(COCC(F)(F)C(F)F)nc(=S)c1C(C)C |
| InChI | InChI=1S/C12H16F4N2OS/c1-6(2)9-7(3)17-8(18-10(9)20)4-19-5-12(15,16)11(13)14/h6,11H,4-5H2,1-3H3,(H,17,18,20) |
| InChIKey | XMRQVYXBQAFAHM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|