C11H12F4N2OS — CID 106477432
2-(2,2,3,3-tetrafluoropropoxymethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477432) has the molecular formula C11H12F4N2OS and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477432 |
| Molecular Formula | C11H12F4N2OS |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)c2c([nH]1)CCC2 |
| InChI | InChI=1S/C11H12F4N2OS/c12-10(13)11(14,15)5-18-4-8-16-7-3-1-2-6(7)9(19)17-8/h10H,1-5H2,(H,16,17,19) |
| InChIKey | CMVWACQBZJUTJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|