C13H16F4N2OS — CID 106481898
6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106481898) has the molecular formula C13H16F4N2OS and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481898 |
| Molecular Formula | C13H16F4N2OS |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6-cyclopentyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)cc(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C13H16F4N2OS/c14-12(15)13(16,17)7-20-6-10-18-9(5-11(21)19-10)8-3-1-2-4-8/h5,8,12H,1-4,6-7H2,(H,18,19,21) |
| InChIKey | GOBMFDMGBUUYPI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|