C11H12F4N2OS — CID 106478440
6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106478440) has the molecular formula C11H12F4N2OS and a molecular weight of 296.29 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478440 |
| Molecular Formula | C11H12F4N2OS |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)cc(C2CC2)[nH]1 |
| InChI | InChI=1S/C11H12F4N2OS/c12-10(13)11(14,15)5-18-4-8-16-7(6-1-2-6)3-9(19)17-8/h3,6,10H,1-2,4-5H2,(H,16,17,19) |
| InChIKey | JLZSZCZZWPUFLO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|