C11H11BrF4N2OS — CID 106480357
5-bromo-6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480357) has the molecular formula C11H11BrF4N2OS and a molecular weight of 375.19 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480357 |
| Molecular Formula | C11H11BrF4N2OS |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)c(Br)c(C2CC2)[nH]1 |
| InChI | InChI=1S/C11H11BrF4N2OS/c12-7-8(5-1-2-5)17-6(18-9(7)20)3-19-4-11(15,16)10(13)14/h5,10H,1-4H2,(H,17,18,20) |
| InChIKey | BSRAYMAEMWBOED-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|