C10H12BrF3N2OS — CID 106480137
5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106480137) has the molecular formula C10H12BrF3N2OS and a molecular weight of 345.18 g/mol. Its IUPAC name is 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480137 |
| Molecular Formula | C10H12BrF3N2OS |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 5-bromo-6-propan-2-yl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(COCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C10H12BrF3N2OS/c1-5(2)8-7(11)9(18)16-6(15-8)3-17-4-10(12,13)14/h5H,3-4H2,1-2H3,(H,15,16,18) |
| InChIKey | JKJDMIWGGXHFKN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|