C9H10BrF3N2OS — CID 106479880
5-bromo-6-ethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106479880) has the molecular formula C9H10BrF3N2OS and a molecular weight of 331.16 g/mol. Its IUPAC name is 5-bromo-6-ethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-ethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479880 |
| Molecular Formula | C9H10BrF3N2OS |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 5-bromo-6-ethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CCc1[nH]c(COCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C9H10BrF3N2OS/c1-2-5-7(10)8(17)15-6(14-5)3-16-4-9(11,12)13/h2-4H2,1H3,(H,14,15,17) |
| InChIKey | HYLXBSKLESDQQK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|