C12H15F3N2OS — CID 106481936
6-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106481936) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 6-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481936 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-cyclopentyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)COCc1nc(=S)cc(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C12H15F3N2OS/c13-12(14,15)7-18-6-10-16-9(5-11(19)17-10)8-3-1-2-4-8/h5,8H,1-4,6-7H2,(H,16,17,19) |
| InChIKey | KRWQYKGQUDQXGW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|