C12H14F4N2OS — CID 106477179
2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477179) has the molecular formula C12H14F4N2OS and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477179 |
| Molecular Formula | C12H14F4N2OS |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)c2c([nH]1)CCCC2 |
| InChI | InChI=1S/C12H14F4N2OS/c13-11(14)12(15,16)6-19-5-9-17-8-4-2-1-3-7(8)10(20)18-9/h11H,1-6H2,(H,17,18,20) |
| InChIKey | LVMJVXKBLFMTFB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|