C12H15F3N2OS — CID 106477125
2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477125) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477125 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | FC(F)(F)COCCc1nc(=S)c2c([nH]1)CCCC2 |
| InChI | InChI=1S/C12H15F3N2OS/c13-12(14,15)7-18-6-5-10-16-9-4-2-1-3-8(9)11(19)17-10/h1-7H2,(H,16,17,19) |
| InChIKey | TXTRCNZHWATJJQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|