C10H12F4N2OS — CID 106476682
5,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106476682) has the molecular formula C10H12F4N2OS and a molecular weight of 284.28 g/mol. Its IUPAC name is 5,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476682 |
| Molecular Formula | C10H12F4N2OS |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5,6-dimethyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(COCC(F)(F)C(F)F)nc(=S)c1C |
| InChI | InChI=1S/C10H12F4N2OS/c1-5-6(2)15-7(16-8(5)18)3-17-4-10(13,14)9(11)12/h9H,3-4H2,1-2H3,(H,15,16,18) |
| InChIKey | CAESLRFEXYOHBI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|