C9H11F3N2OS — CID 106476716
5,6-dimethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106476716) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is 5,6-dimethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5,6-dimethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476716 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5,6-dimethyl-2-(2,2,2-trifluoroethoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(COCC(F)(F)F)nc(=S)c1C |
| InChI | InChI=1S/C9H11F3N2OS/c1-5-6(2)13-7(14-8(5)16)3-15-4-9(10,11)12/h3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | UFDBPEZDDCPCCP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|