C10H10F4N2OS2 — CID 106481638
2-(2,2,3,3-tetrafluoropropoxymethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481638) has the molecular formula C10H10F4N2OS2 and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481638 |
| Molecular Formula | C10H10F4N2OS2 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | FC(F)C(F)(F)COCc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C10H10F4N2OS2/c11-9(12)10(13,14)4-17-1-7-15-6-3-19-2-5(6)8(18)16-7/h9H,1-4H2,(H,15,16,18) |
| InChIKey | VQEIASLVUZVOTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|