C10H11F3N2OS2 — CID 106481580
2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481580) has the molecular formula C10H11F3N2OS2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481580 |
| Molecular Formula | C10H11F3N2OS2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | FC(F)(F)COCCc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C10H11F3N2OS2/c11-10(12,13)5-16-2-1-8-14-7-4-18-3-6(7)9(17)15-8/h1-5H2,(H,14,15,17) |
| InChIKey | QSBRSXSHYVDBLA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|