C10H14N2OS2 — CID 106481566
2-(3-methoxypropyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481566) has the molecular formula C10H14N2OS2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(3-methoxypropyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481566 |
| Molecular Formula | C10H14N2OS2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(3-methoxypropyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | COCCCc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C10H14N2OS2/c1-13-4-2-3-9-11-8-6-15-5-7(8)10(14)12-9/h2-6H2,1H3,(H,11,12,14) |
| InChIKey | MYNMEFOHZQIMCV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|