C12H17F3N2OS — CID 106477880
6-methyl-5-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106477880) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-5-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477880 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 6-methyl-5-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CCOCC(F)(F)F)nc(=S)c1C(C)C |
| InChI | InChI=1S/C12H17F3N2OS/c1-7(2)10-8(3)16-9(17-11(10)19)4-5-18-6-12(13,14)15/h7H,4-6H2,1-3H3,(H,16,17,19) |
| InChIKey | WXULEARNVDUSIN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|