C11H13BrF2N2OS — CID 106480302
5-bromo-6-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106480302) has the molecular formula C11H13BrF2N2OS and a molecular weight of 339.21 g/mol. Its IUPAC name is 5-bromo-6-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480302 |
| Molecular Formula | C11H13BrF2N2OS |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 5-bromo-6-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | FC(F)COCCc1nc(=S)c(Br)c(C2CC2)[nH]1 |
| InChI | InChI=1S/C11H13BrF2N2OS/c12-9-10(6-1-2-6)15-8(16-11(9)18)3-4-17-5-7(13)14/h6-7H,1-5H2,(H,15,16,18) |
| InChIKey | JRSPCWSXXRYPNW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|