C10H12BrF3N2OS — CID 106479782
5-bromo-6-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106479782) has the molecular formula C10H12BrF3N2OS and a molecular weight of 345.18 g/mol. Its IUPAC name is 5-bromo-6-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479782 |
| Molecular Formula | C10H12BrF3N2OS |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 5-bromo-6-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | CCc1[nH]c(CCOCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C10H12BrF3N2OS/c1-2-6-8(11)9(18)16-7(15-6)3-4-17-5-10(12,13)14/h2-5H2,1H3,(H,15,16,18) |
| InChIKey | ATCYKSZWODJRKO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|