C11H14BrF3N2OS — CID 106480046
5-bromo-6-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106480046) has the molecular formula C11H14BrF3N2OS and a molecular weight of 359.21 g/mol. Its IUPAC name is 5-bromo-6-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480046 |
| Molecular Formula | C11H14BrF3N2OS |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 5-bromo-6-propan-2-yl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1[nH]c(CCOCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C11H14BrF3N2OS/c1-6(2)9-8(12)10(19)17-7(16-9)3-4-18-5-11(13,14)15/h6H,3-5H2,1-2H3,(H,16,17,19) |
| InChIKey | PKQWULAZCMHVKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|