C12H16BrF3N2OS — CID 106481081
5-bromo-6-(2-methylpropyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione (PubChem CID 106481081) has the molecular formula C12H16BrF3N2OS and a molecular weight of 373.24 g/mol. Its IUPAC name is 5-bromo-6-(2-methylpropyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(2-methylpropyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481081 |
| Molecular Formula | C12H16BrF3N2OS |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 5-bromo-6-(2-methylpropyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(CCOCC(F)(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C12H16BrF3N2OS/c1-7(2)5-8-10(13)11(20)18-9(17-8)3-4-19-6-12(14,15)16/h7H,3-6H2,1-2H3,(H,17,18,20) |
| InChIKey | NCRIFKUSJQIDKQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|