C12H20N2S — CID 106475500
2-(2,2-dimethylpropyl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106475500) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-(2,2-dimethylpropyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475500 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1cc(=S)nc(CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H20N2S/c1-8(2)9-6-11(15)14-10(13-9)7-12(3,4)5/h6,8H,7H2,1-5H3,(H,13,14,15) |
| InChIKey | YTHHKHKHHJOUKX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|