C10H15N3S2 — CID 106475577
6-methyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106475577) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 6-methyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475577 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-methyl-2-(4-methylthiomorpholin-3-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(C2CSCCN2C)[nH]1 |
| InChI | InChI=1S/C10H15N3S2/c1-7-5-9(14)12-10(11-7)8-6-15-4-3-13(8)2/h5,8H,3-4,6H2,1-2H3,(H,11,12,14) |
| InChIKey | OPWLQRAMLBKMKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|