C11H15N3S3 — CID 106481555
2-(4-methylthiomorpholin-3-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481555) has the molecular formula C11H15N3S3 and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-(4-methylthiomorpholin-3-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(4-methylthiomorpholin-3-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481555 |
| Molecular Formula | C11H15N3S3 |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(4-methylthiomorpholin-3-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | CN1CCSCC1c1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C11H15N3S3/c1-14-2-3-16-6-9(14)10-12-8-5-17-4-7(8)11(15)13-10/h9H,2-6H2,1H3,(H,12,13,15) |
| InChIKey | KLYQWRXIMNUMCN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|