C11H14N2S4 — CID 106481546
2-(3-methyl-1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481546) has the molecular formula C11H14N2S4 and a molecular weight of 302.52 g/mol. Its IUPAC name is 2-(3-methyl-1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(3-methyl-1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481546 |
| Molecular Formula | C11H14N2S4 |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-(3-methyl-1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | CC1SCCSC1c1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C11H14N2S4/c1-6-9(17-3-2-16-6)10-12-8-5-15-4-7(8)11(14)13-10/h6,9H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | MUXZSKUQLKEITA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|