C12H18N2S3 — CID 106476835
5-ethyl-6-methyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106476835) has the molecular formula C12H18N2S3 and a molecular weight of 286.49 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-ethyl-6-methyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476835 |
| Molecular Formula | C12H18N2S3 |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-ethyl-6-methyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCc1c(C)[nH]c(C2SCCSC2C)nc1=S |
| InChI | InChI=1S/C12H18N2S3/c1-4-9-7(2)13-11(14-12(9)15)10-8(3)16-5-6-17-10/h8,10H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | QNCLEOBYXKFFMB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|