C9H13N3S2 — CID 106481699
2-[(dimethylamino)methyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481699) has the molecular formula C9H13N3S2 and a molecular weight of 227.36 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-[(dimethylamino)methyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481699 |
| Molecular Formula | C9H13N3S2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-[(dimethylamino)methyl]-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | CN(C)Cc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C9H13N3S2/c1-12(2)3-8-10-7-5-14-4-6(7)9(13)11-8/h3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | GSOKDDPQRZXHDV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|