C7H8N2S2 — CID 106481535
2-methyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481535) has the molecular formula C7H8N2S2 and a molecular weight of 184.29 g/mol. Its IUPAC name is 2-methyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-methyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481535 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2-methyl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C7H8N2S2/c1-4-8-6-3-11-2-5(6)7(10)9-4/h2-3H2,1H3,(H,8,9,10) |
| InChIKey | MZHNJPXLKGAWEI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|