C13H20N2S2 — CID 106476698
2-(cyclohexylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106476698) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-(cyclohexylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(cyclohexylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476698 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(cyclohexylsulfanylmethyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(CSC2CCCCC2)nc(=S)c1C |
| InChI | InChI=1S/C13H20N2S2/c1-9-10(2)14-12(15-13(9)16)8-17-11-6-4-3-5-7-11/h11H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | BPBXIMGDFSJUBY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|