C7H7F3N2S — CID 106475581
6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione (PubChem CID 106475581) has the molecular formula C7H7F3N2S and a molecular weight of 208.21 g/mol. Its IUPAC name is 6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475581 |
| Molecular Formula | C7H7F3N2S |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 6-methyl-2-(2,2,2-trifluoroethyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(CC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C7H7F3N2S/c1-4-2-6(13)12-5(11-4)3-7(8,9)10/h2H,3H2,1H3,(H,11,12,13) |
| InChIKey | LDYMGHWHUZUEIG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|