C17H24N2S — CID 106475592
2-(3,5-dimethyl-1-adamantyl)-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106475592) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475592 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-6-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(C23CC4CC(C)(CC(C)(C4)C2)C3)[nH]1 |
| InChI | InChI=1S/C17H24N2S/c1-11-4-13(20)19-14(18-11)17-7-12-5-15(2,9-17)8-16(3,6-12)10-17/h4,12H,5-10H2,1-3H3,(H,18,19,20) |
| InChIKey | XJUWNHSPFQPYJH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|